About 2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole
2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 3000039) has the molecular formula C11H9N3S
and a molecular weight of 215.28 g/mol. Its IUPAC name is 2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole.
Molecular Properties
| Compound Name | 2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole |
| PubChem CID | 3000039 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | Cc1nn2cc(-c3ccccc3)nc2s1 |
| InChI | InChI=1S/C11H9N3S/c1-8-13-14-7-10(12-11(14)15-8)9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | NUMSBSZXHFWUTI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole?
The IUPAC name of 2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole (CID 3000039) is 2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole.
What is the SMILES notation for 2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole?
The canonical SMILES for 2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole is Cc1nn2cc(-c3ccccc3)nc2s1.
What is the InChIKey of 2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole?
The InChIKey is NUMSBSZXHFWUTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3S/c1-8-13-14-7-10(12-11(14)15-8)9-5-3-2-4-6-9/h2-7H,1H3.
What are the key properties of 2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole?
2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole has a molecular weight of 215.28 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazole is sourced from PubChem (CID 3000039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).