C19H24ClN5OS — CID 3000056
6-(4-chlorophenyl)-N-cyclohexyl-N,3-dimethyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 3000056) has the molecular formula C19H24ClN5OS and a molecular weight of 405.96 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-cyclohexyl-N,3-dimethyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-N-cyclohexyl-N,3-dimethyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 3000056 |
| Molecular Formula | C19H24ClN5OS |
| Molecular Weight | 405.96 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 6-(4-chlorophenyl)-N-cyclohexyl-N,3-dimethyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | Cc1nnc2n1NC(c1ccc(Cl)cc1)C(C(=O)N(C)C1CCCCC1)S2 |
| InChI | InChI=1S/C19H24ClN5OS/c1-12-21-22-19-25(12)23-16(13-8-10-14(20)11-9-13)17(27-19)18(26)24(2)15-6-4-3-5-7-15/h8-11,15-17,23H,3-7H2,1-2H3 |
| InChIKey | XECJIESDJYAMQM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.96 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |