About 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide (PubChem CID 3000091) has the molecular formula C16H21N5OS
and a molecular weight of 331.45 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide |
| PubChem CID | 3000091 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide |
| SMILES | CC(CCc1ccccc1)NC(=O)CSc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C16H21N5OS/c1-11(7-8-12-5-3-2-4-6-12)19-15(22)10-23-16-20-13(17)9-14(18)21-16/h2-6,9,11H,7-8,10H2,1H3,(H,19,22)(H4,17,18,20,21) |
| InChIKey | RKDJUVNFVJUQJY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide?
The IUPAC name of 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide (CID 3000091) is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide.
What is the SMILES notation for 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide?
The canonical SMILES for 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide is CC(CCc1ccccc1)NC(=O)CSc1nc(N)cc(N)n1.
What is the InChIKey of 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide?
The InChIKey is RKDJUVNFVJUQJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N5OS/c1-11(7-8-12-5-3-2-4-6-12)19-15(22)10-23-16-20-13(17)9-14(18)21-16/h2-6,9,11H,7-8,10H2,1H3,(H,19,22)(H4,17,18,20,21).
What are the key properties of 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide?
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide has a molecular weight of 331.45 g/mol, XLogP of 1.87, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide is sourced from PubChem (CID 3000091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).