C11H13NO — CID 30001
1,3,3-trimethylindol-2-one (PubChem CID 30001) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 1,3,3-trimethylindol-2-one.
| Compound Name | 1,3,3-trimethylindol-2-one |
|---|---|
| PubChem CID | 30001 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1,3,3-trimethylindol-2-one |
| SMILES | CN1C(=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C11H13NO/c1-11(2)8-6-4-5-7-9(8)12(3)10(11)13/h4-7H,1-3H3 |
| InChIKey | RFJITKCIMOLCNP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |