C18H18F3N3O4S — CID 3000138
1-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 3000138) has the molecular formula C18H18F3N3O4S and a molecular weight of 429.42 g/mol. Its IUPAC name is 1-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 3000138 |
| Molecular Formula | C18H18F3N3O4S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 1-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | O=C(Cn1cc(C(F)(F)F)ccc1=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H18F3N3O4S/c19-18(20,21)14-6-7-16(25)23(12-14)13-17(26)22-8-10-24(11-9-22)29(27,28)15-4-2-1-3-5-15/h1-7,12H,8-11,13H2 |
| InChIKey | RCUFOYSENDCYLU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |