About 2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide
2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide (PubChem CID 3000167) has the molecular formula C17H16N4O2S
and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide.
Molecular Properties
| Compound Name | 2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide |
| PubChem CID | 3000167 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cc(N2CCOCC2)nc2ccccc12 |
| InChI | InChI=1S/C17H16N4O2S/c22-16(20-17-18-5-10-24-17)13-11-15(21-6-8-23-9-7-21)19-14-4-2-1-3-12(13)14/h1-5,10-11H,6-9H2,(H,18,20,22) |
| InChIKey | SJLBRSASZYCGKR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide?
The IUPAC name of 2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide (CID 3000167) is 2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide.
What is the SMILES notation for 2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide?
The canonical SMILES for 2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide is O=C(Nc1nccs1)c1cc(N2CCOCC2)nc2ccccc12.
What is the InChIKey of 2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide?
The InChIKey is SJLBRSASZYCGKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O2S/c22-16(20-17-18-5-10-24-17)13-11-15(21-6-8-23-9-7-21)19-14-4-2-1-3-12(13)14/h1-5,10-11H,6-9H2,(H,18,20,22).
What are the key properties of 2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide?
2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide has a molecular weight of 340.41 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yl-N-(1,3-thiazol-2-yl)quinoline-4-carboxamide is sourced from PubChem (CID 3000167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).