C18H29N3O4 — CID 3000204
3-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione (PubChem CID 3000204) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione.
| Compound Name | 3-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione |
|---|---|
| PubChem CID | 3000204 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 3-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione |
| SMILES | CC1CN(C(=O)CN2C(=O)NC3(CCCCCCC3)C2=O)CC(C)O1 |
| InChI | InChI=1S/C18H29N3O4/c1-13-10-20(11-14(2)25-13)15(22)12-21-16(23)18(19-17(21)24)8-6-4-3-5-7-9-18/h13-14H,3-12H2,1-2H3,(H,19,24) |
| InChIKey | GTODZIATXSOLIM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|