About 4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide
4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide (PubChem CID 3000619) has the molecular formula C20H22N4O2S2
and a molecular weight of 414.56 g/mol. Its IUPAC name is 4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide |
| PubChem CID | 3000619 |
| Molecular Formula | C20H22N4O2S2 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide |
| SMILES | CCc1cc(C(N)=S)ccn1.Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C12H12N2O2S.C8H10N2S/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;1-2-7-5-6(8(9)11)3-4-10-7/h1-8H,13-14H2;3-5H,2H2,1H3,(H2,9,11) |
| InChIKey | GZTSDOLYHPDVEC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide?
The IUPAC name of 4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide (CID 3000619) is 4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide.
What is the SMILES notation for 4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide?
The canonical SMILES for 4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide is CCc1cc(C(N)=S)ccn1.Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1.
What is the InChIKey of 4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide?
The InChIKey is GZTSDOLYHPDVEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S.C8H10N2S/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;1-2-7-5-6(8(9)11)3-4-10-7/h1-8H,13-14H2;3-5H,2H2,1H3,(H2,9,11).
What are the key properties of 4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide?
4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide has a molecular weight of 414.56 g/mol, XLogP of 2.96, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)sulfonylaniline;2-ethylpyridine-4-carbothioamide is sourced from PubChem (CID 3000619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).