C9H9N3O2S3 — CID 3000624
(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl) N-methylcarbamodithioate (PubChem CID 3000624) has the molecular formula C9H9N3O2S3 and a molecular weight of 287.39 g/mol. Its IUPAC name is (1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl) N-methylcarbamodithioate.
| Compound Name | (1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl) N-methylcarbamodithioate |
|---|---|
| PubChem CID | 3000624 |
| Molecular Formula | C9H9N3O2S3 |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | (1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl) N-methylcarbamodithioate |
| SMILES | CNC(=S)SC1=NS(=O)(=O)c2ccccc2N1 |
| InChI | InChI=1S/C9H9N3O2S3/c1-10-9(15)16-8-11-6-4-2-3-5-7(6)17(13,14)12-8/h2-5H,1H3,(H,10,15)(H,11,12) |
| InChIKey | GAAWVSXXMPHDDL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|