C21H24N6S — CID 3000691
N'-(1-isoquinolin-1-ylethyl)-4-pyridin-2-ylpiperazine-1-carbothiohydrazide (PubChem CID 3000691) has the molecular formula C21H24N6S and a molecular weight of 392.53 g/mol. Its IUPAC name is N'-(1-isoquinolin-1-ylethyl)-4-pyridin-2-ylpiperazine-1-carbothiohydrazide.
| Compound Name | N'-(1-isoquinolin-1-ylethyl)-4-pyridin-2-ylpiperazine-1-carbothiohydrazide |
|---|---|
| PubChem CID | 3000691 |
| Molecular Formula | C21H24N6S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N'-(1-isoquinolin-1-ylethyl)-4-pyridin-2-ylpiperazine-1-carbothiohydrazide |
| SMILES | CC(NNC(=S)N1CCN(c2ccccn2)CC1)c1nccc2ccccc12 |
| InChI | InChI=1S/C21H24N6S/c1-16(20-18-7-3-2-6-17(18)9-11-23-20)24-25-21(28)27-14-12-26(13-15-27)19-8-4-5-10-22-19/h2-11,16,24H,12-15H2,1H3,(H,25,28) |
| InChIKey | KLYOLLLMOLFUSQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|