C14H22Cl2N2O2 — CID 30007
2-[(3-chloro-2-methylphenyl)carbamoyloxy]ethyl-diethylazanium chloride (PubChem CID 30007) has the molecular formula C14H22Cl2N2O2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 2-[(3-chloro-2-methylphenyl)carbamoyloxy]ethyl-diethylazanium chloride.
| Compound Name | 2-[(3-chloro-2-methylphenyl)carbamoyloxy]ethyl-diethylazanium chloride |
|---|---|
| PubChem CID | 30007 |
| Molecular Formula | C14H22Cl2N2O2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-[(3-chloro-2-methylphenyl)carbamoyloxy]ethyl-diethylazanium chloride |
| SMILES | CC[NH+](CC)CCOC(=O)Nc1cccc(Cl)c1C.[Cl-] |
| InChI | InChI=1S/C14H21ClN2O2.ClH/c1-4-17(5-2)9-10-19-14(18)16-13-8-6-7-12(15)11(13)3;/h6-8H,4-5,9-10H2,1-3H3,(H,16,18);1H |
| InChIKey | OCQOORUHFZXKCQ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |