About 1-butyl-1,3-diazinane-2-thione
1-butyl-1,3-diazinane-2-thione (PubChem CID 3000716) has the molecular formula C8H16N2S
and a molecular weight of 172.30 g/mol. Its IUPAC name is 1-butyl-1,3-diazinane-2-thione.
Molecular Properties
| Compound Name | 1-butyl-1,3-diazinane-2-thione |
| PubChem CID | 3000716 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 1-butyl-1,3-diazinane-2-thione |
| SMILES | CCCCN1CCCNC1=S |
| InChI | InChI=1S/C8H16N2S/c1-2-3-6-10-7-4-5-9-8(10)11/h2-7H2,1H3,(H,9,11) |
| InChIKey | CUPVPSOUKBSAHR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-1,3-diazinane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1,3-diazinane-2-thione?
The IUPAC name of 1-butyl-1,3-diazinane-2-thione (CID 3000716) is 1-butyl-1,3-diazinane-2-thione.
What is the SMILES notation for 1-butyl-1,3-diazinane-2-thione?
The canonical SMILES for 1-butyl-1,3-diazinane-2-thione is CCCCN1CCCNC1=S.
What is the InChIKey of 1-butyl-1,3-diazinane-2-thione?
The InChIKey is CUPVPSOUKBSAHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S/c1-2-3-6-10-7-4-5-9-8(10)11/h2-7H2,1H3,(H,9,11).
What are the key properties of 1-butyl-1,3-diazinane-2-thione?
1-butyl-1,3-diazinane-2-thione has a molecular weight of 172.30 g/mol, XLogP of 1.37, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1,3-diazinane-2-thione is sourced from PubChem (CID 3000716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).