About 3H-1,3-benzothiazole-2-thione;zinc
3H-1,3-benzothiazole-2-thione;zinc (PubChem CID 3000735) has the molecular formula C7H5NS2Zn
and a molecular weight of 232.65 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;zinc.
Molecular Properties
| Compound Name | 3H-1,3-benzothiazole-2-thione;zinc |
| PubChem CID | 3000735 |
| Molecular Formula | C7H5NS2Zn |
| Molecular Weight | 232.65 g/mol |
| Exact Mass | 230.92 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;zinc |
| SMILES | S=c1[nH]c2ccccc2s1.[Zn] |
| InChI | InChI=1S/C7H5NS2.Zn/c9-7-8-5-3-1-2-4-6(5)10-7;/h1-4H,(H,8,9); |
| InChIKey | GIUBHMDTOCBOPA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.65 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3H-1,3-benzothiazole-2-thione;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1,3-benzothiazole-2-thione;zinc?
The IUPAC name of 3H-1,3-benzothiazole-2-thione;zinc (CID 3000735) is 3H-1,3-benzothiazole-2-thione;zinc.
What is the SMILES notation for 3H-1,3-benzothiazole-2-thione;zinc?
The canonical SMILES for 3H-1,3-benzothiazole-2-thione;zinc is S=c1[nH]c2ccccc2s1.[Zn].
What is the InChIKey of 3H-1,3-benzothiazole-2-thione;zinc?
The InChIKey is GIUBHMDTOCBOPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS2.Zn/c9-7-8-5-3-1-2-4-6(5)10-7;/h1-4H,(H,8,9);.
What are the key properties of 3H-1,3-benzothiazole-2-thione;zinc?
3H-1,3-benzothiazole-2-thione;zinc has a molecular weight of 232.65 g/mol, XLogP of 2.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,3-benzothiazole-2-thione;zinc is sourced from PubChem (CID 3000735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).