About 4-(aminomethyl)-1,3-dihydroimidazole-2-thione
4-(aminomethyl)-1,3-dihydroimidazole-2-thione (PubChem CID 3000739) has the molecular formula C4H7N3S
and a molecular weight of 129.19 g/mol. Its IUPAC name is 4-(aminomethyl)-1,3-dihydroimidazole-2-thione.
Molecular Properties
| Compound Name | 4-(aminomethyl)-1,3-dihydroimidazole-2-thione |
| PubChem CID | 3000739 |
| Molecular Formula | C4H7N3S |
| Molecular Weight | 129.19 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 4-(aminomethyl)-1,3-dihydroimidazole-2-thione |
| SMILES | NCc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C4H7N3S/c5-1-3-2-6-4(8)7-3/h2H,1,5H2,(H2,6,7,8) |
| InChIKey | JYOQUFAUDMUWJB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 57.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(aminomethyl)-1,3-dihydroimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-1,3-dihydroimidazole-2-thione?
The IUPAC name of 4-(aminomethyl)-1,3-dihydroimidazole-2-thione (CID 3000739) is 4-(aminomethyl)-1,3-dihydroimidazole-2-thione.
What is the SMILES notation for 4-(aminomethyl)-1,3-dihydroimidazole-2-thione?
The canonical SMILES for 4-(aminomethyl)-1,3-dihydroimidazole-2-thione is NCc1c[nH]c(=S)[nH]1.
What is the InChIKey of 4-(aminomethyl)-1,3-dihydroimidazole-2-thione?
The InChIKey is JYOQUFAUDMUWJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3S/c5-1-3-2-6-4(8)7-3/h2H,1,5H2,(H2,6,7,8).
What are the key properties of 4-(aminomethyl)-1,3-dihydroimidazole-2-thione?
4-(aminomethyl)-1,3-dihydroimidazole-2-thione has a molecular weight of 129.19 g/mol, XLogP of 0.53, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-1,3-dihydroimidazole-2-thione is sourced from PubChem (CID 3000739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).