C18H24BrN3S — CID 3000785
(11S)-7-bromo-10-(3-ethylpent-2-enyl)-11-methyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-thione (PubChem CID 3000785) has the molecular formula C18H24BrN3S and a molecular weight of 394.38 g/mol. Its IUPAC name is (11S)-7-bromo-10-(3-ethylpent-2-enyl)-11-methyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-thione.
| Compound Name | (11S)-7-bromo-10-(3-ethylpent-2-enyl)-11-methyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-thione |
|---|---|
| PubChem CID | 3000785 |
| Molecular Formula | C18H24BrN3S |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | (11S)-7-bromo-10-(3-ethylpent-2-enyl)-11-methyl-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-thione |
| SMILES | CCC(=CCN1Cc2c(Br)ccc3[nH]c(=S)n(c23)C[C@@H]1C)CC |
| InChI | InChI=1S/C18H24BrN3S/c1-4-13(5-2)8-9-21-11-14-15(19)6-7-16-17(14)22(10-12(21)3)18(23)20-16/h6-8,12H,4-5,9-11H2,1-3H3,(H,20,23)/t12-/m0/s1 |
| InChIKey | FSGXHRCEWOFPRV-LBPRGKRZSA-N |
| XLogP | 5.41 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|