C9H6N4S2 — CID 3000839
11-methyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-6-thione (PubChem CID 3000839) has the molecular formula C9H6N4S2 and a molecular weight of 234.31 g/mol. Its IUPAC name is 11-methyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-6-thione.
| Compound Name | 11-methyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-6-thione |
|---|---|
| PubChem CID | 3000839 |
| Molecular Formula | C9H6N4S2 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 11-methyl-8-thia-3,4,5,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-6-thione |
| SMILES | Cc1ccc2c(n1)sc1c(=S)nn[nH]c12 |
| InChI | InChI=1S/C9H6N4S2/c1-4-2-3-5-6-7(15-9(5)10-4)8(14)12-13-11-6/h2-3H,1H3,(H,11,12,14) |
| InChIKey | QFLHJODVLMVAQJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|