C18H26N4S — CID 3000855
10-(3-ethylpent-2-enyl)-7,11-dimethyl-1,3,6,10-tetrazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-thione (PubChem CID 3000855) has the molecular formula C18H26N4S and a molecular weight of 330.50 g/mol. Its IUPAC name is 10-(3-ethylpent-2-enyl)-7,11-dimethyl-1,3,6,10-tetrazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-thione.
| Compound Name | 10-(3-ethylpent-2-enyl)-7,11-dimethyl-1,3,6,10-tetrazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-thione |
|---|---|
| PubChem CID | 3000855 |
| Molecular Formula | C18H26N4S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 10-(3-ethylpent-2-enyl)-7,11-dimethyl-1,3,6,10-tetrazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-thione |
| SMILES | CCC(=CCN1Cc2c(C)ncc3[nH]c(=S)n(c23)CC1C)CC |
| InChI | InChI=1S/C18H26N4S/c1-5-14(6-2)7-8-21-11-15-13(4)19-9-16-17(15)22(10-12(21)3)18(23)20-16/h7,9,12H,5-6,8,10-11H2,1-4H3,(H,20,23) |
| InChIKey | CUZOKYRINGHTIK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|