About N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide
N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide (PubChem CID 3000936) has the molecular formula C17H20ClNO2S
and a molecular weight of 337.87 g/mol. Its IUPAC name is N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide.
Molecular Properties
| Compound Name | N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide |
| PubChem CID | 3000936 |
| Molecular Formula | C17H20ClNO2S |
| Molecular Weight | 337.87 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide |
| SMILES | Cc1occc1C(=S)Nc1ccc(Cl)c(OCC(C)(C)C)c1 |
| InChI | InChI=1S/C17H20ClNO2S/c1-11-13(7-8-20-11)16(22)19-12-5-6-14(18)15(9-12)21-10-17(2,3)4/h5-9H,10H2,1-4H3,(H,19,22) |
| InChIKey | CCAIDGVYLWQFSQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.87 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide?
The IUPAC name of N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide (CID 3000936) is N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide.
What is the SMILES notation for N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide?
The canonical SMILES for N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide is Cc1occc1C(=S)Nc1ccc(Cl)c(OCC(C)(C)C)c1.
What is the InChIKey of N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide?
The InChIKey is CCAIDGVYLWQFSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClNO2S/c1-11-13(7-8-20-11)16(22)19-12-5-6-14(18)15(9-12)21-10-17(2,3)4/h5-9H,10H2,1-4H3,(H,19,22).
What are the key properties of N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide?
N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide has a molecular weight of 337.87 g/mol, XLogP of 5.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-chloro-3-(2,2-dimethylpropoxy)phenyl]-2-methylfuran-3-carbothioamide is sourced from PubChem (CID 3000936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).