C15H12ClF2N3S — CID 3001036
1-(5-chloro-2-pyridinyl)-3-[(1R,2R)-2-(2,6-difluorophenyl)cyclopropyl]thiourea (PubChem CID 3001036) has the molecular formula C15H12ClF2N3S and a molecular weight of 339.80 g/mol. Its IUPAC name is 1-(5-chloro-2-pyridinyl)-3-[(1R,2R)-2-(2,6-difluorophenyl)cyclopropyl]thiourea.
| Compound Name | 1-(5-chloro-2-pyridinyl)-3-[(1R,2R)-2-(2,6-difluorophenyl)cyclopropyl]thiourea |
|---|---|
| PubChem CID | 3001036 |
| Molecular Formula | C15H12ClF2N3S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 1-(5-chloro-2-pyridinyl)-3-[(1R,2R)-2-(2,6-difluorophenyl)cyclopropyl]thiourea |
| SMILES | Fc1cccc(F)c1[C@H]1C[C@H]1NC(=S)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H12ClF2N3S/c16-8-4-5-13(19-7-8)21-15(22)20-12-6-9(12)14-10(17)2-1-3-11(14)18/h1-5,7,9,12H,6H2,(H2,19,20,21,22)/t9-,12+/m0/s1 |
| InChIKey | MLQMPUODICNZDI-JOYOIKCWSA-N |
| XLogP | 3.86 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|