About 1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea
1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea (PubChem CID 3001107) has the molecular formula C15H19N3S2
and a molecular weight of 305.47 g/mol. Its IUPAC name is 1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea.
Molecular Properties
| Compound Name | 1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea |
| PubChem CID | 3001107 |
| Molecular Formula | C15H19N3S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea |
| SMILES | CCCc1csc(NC(=S)NCCc2ccccc2)n1 |
| InChI | InChI=1S/C15H19N3S2/c1-2-6-13-11-20-15(17-13)18-14(19)16-10-9-12-7-4-3-5-8-12/h3-5,7-8,11H,2,6,9-10H2,1H3,(H2,16,17,18,19) |
| InChIKey | YVTPTTMDIAAXHM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea?
The IUPAC name of 1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea (CID 3001107) is 1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea.
What is the SMILES notation for 1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea?
The canonical SMILES for 1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea is CCCc1csc(NC(=S)NCCc2ccccc2)n1.
What is the InChIKey of 1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea?
The InChIKey is YVTPTTMDIAAXHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3S2/c1-2-6-13-11-20-15(17-13)18-14(19)16-10-9-12-7-4-3-5-8-12/h3-5,7-8,11H,2,6,9-10H2,1H3,(H2,16,17,18,19).
What are the key properties of 1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea?
1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea has a molecular weight of 305.47 g/mol, XLogP of 3.62, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-phenylethyl)-3-(4-propyl-1,3-thiazol-2-yl)thiourea is sourced from PubChem (CID 3001107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).