About 1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea
1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea (PubChem CID 3001109) has the molecular formula C16H21N3S2
and a molecular weight of 319.50 g/mol. Its IUPAC name is 1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea.
Molecular Properties
| Compound Name | 1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea |
| PubChem CID | 3001109 |
| Molecular Formula | C16H21N3S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea |
| SMILES | CCCCc1csc(NC(=S)NCCc2ccccc2)n1 |
| InChI | InChI=1S/C16H21N3S2/c1-2-3-9-14-12-21-16(18-14)19-15(20)17-11-10-13-7-5-4-6-8-13/h4-8,12H,2-3,9-11H2,1H3,(H2,17,18,19,20) |
| InChIKey | SXKJLZJKVYKNHV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea?
The IUPAC name of 1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea (CID 3001109) is 1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea.
What is the SMILES notation for 1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea?
The canonical SMILES for 1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea is CCCCc1csc(NC(=S)NCCc2ccccc2)n1.
What is the InChIKey of 1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea?
The InChIKey is SXKJLZJKVYKNHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3S2/c1-2-3-9-14-12-21-16(18-14)19-15(20)17-11-10-13-7-5-4-6-8-13/h4-8,12H,2-3,9-11H2,1H3,(H2,17,18,19,20).
What are the key properties of 1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea?
1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea has a molecular weight of 319.50 g/mol, XLogP of 4.01, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-butyl-1,3-thiazol-2-yl)-3-(2-phenylethyl)thiourea is sourced from PubChem (CID 3001109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).