C16H11Cl3N4O2S — CID 3001145
1-(5-chloro-2-pyridinyl)-3-[2-(4,7-dichloro-1,3-dioxoisoindol-2-yl)ethyl]thiourea (PubChem CID 3001145) has the molecular formula C16H11Cl3N4O2S and a molecular weight of 429.72 g/mol. Its IUPAC name is 1-(5-chloro-2-pyridinyl)-3-[2-(4,7-dichloro-1,3-dioxoisoindol-2-yl)ethyl]thiourea.
| Compound Name | 1-(5-chloro-2-pyridinyl)-3-[2-(4,7-dichloro-1,3-dioxoisoindol-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 3001145 |
| Molecular Formula | C16H11Cl3N4O2S |
| Molecular Weight | 429.72 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | 1-(5-chloro-2-pyridinyl)-3-[2-(4,7-dichloro-1,3-dioxoisoindol-2-yl)ethyl]thiourea |
| SMILES | O=C1c2c(Cl)ccc(Cl)c2C(=O)N1CCNC(=S)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H11Cl3N4O2S/c17-8-1-4-11(21-7-8)22-16(26)20-5-6-23-14(24)12-9(18)2-3-10(19)13(12)15(23)25/h1-4,7H,5-6H2,(H2,20,21,22,26) |
| InChIKey | VCFANMMZFZDTIY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.72 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|