C16H16ClFIN3OS — CID 3001153
1-[2-(2-chloro-3-ethoxy-6-fluorophenyl)ethyl]-3-(5-iodo-2-pyridinyl)thiourea (PubChem CID 3001153) has the molecular formula C16H16ClFIN3OS and a molecular weight of 479.75 g/mol. Its IUPAC name is 1-[2-(2-chloro-3-ethoxy-6-fluorophenyl)ethyl]-3-(5-iodo-2-pyridinyl)thiourea.
| Compound Name | 1-[2-(2-chloro-3-ethoxy-6-fluorophenyl)ethyl]-3-(5-iodo-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 3001153 |
| Molecular Formula | C16H16ClFIN3OS |
| Molecular Weight | 479.75 g/mol |
| Exact Mass | 478.97 |
| IUPAC Name | 1-[2-(2-chloro-3-ethoxy-6-fluorophenyl)ethyl]-3-(5-iodo-2-pyridinyl)thiourea |
| SMILES | CCOc1ccc(F)c(CCNC(=S)Nc2ccc(I)cn2)c1Cl |
| InChI | InChI=1S/C16H16ClFIN3OS/c1-2-23-13-5-4-12(18)11(15(13)17)7-8-20-16(24)22-14-6-3-10(19)9-21-14/h3-6,9H,2,7-8H2,1H3,(H2,20,21,22,24) |
| InChIKey | JJMUSKOQMJXJNA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.75 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|