C20H21N5S2 — CID 3001226
1-[4-[4-(2-phenylethyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]phenyl]-3-prop-2-enylthiourea (PubChem CID 3001226) has the molecular formula C20H21N5S2 and a molecular weight of 395.56 g/mol. Its IUPAC name is 1-[4-[4-(2-phenylethyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]phenyl]-3-prop-2-enylthiourea.
| Compound Name | 1-[4-[4-(2-phenylethyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]phenyl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 3001226 |
| Molecular Formula | C20H21N5S2 |
| Molecular Weight | 395.56 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 1-[4-[4-(2-phenylethyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]phenyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1ccc(-c2n[nH]c(=S)n2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H21N5S2/c1-2-13-21-19(26)22-17-10-8-16(9-11-17)18-23-24-20(27)25(18)14-12-15-6-4-3-5-7-15/h2-11H,1,12-14H2,(H,24,27)(H2,21,22,26) |
| InChIKey | NIBWZASBWCADEX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 57.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|