C15H22Cl2N2O2 — CID 30013
2-piperidin-1-ium-1-ylethyl N-(5-chloro-2-methylphenyl)carbamate chloride (PubChem CID 30013) has the molecular formula C15H22Cl2N2O2 and a molecular weight of 333.26 g/mol. Its IUPAC name is 2-piperidin-1-ium-1-ylethyl N-(5-chloro-2-methylphenyl)carbamate chloride.
| Compound Name | 2-piperidin-1-ium-1-ylethyl N-(5-chloro-2-methylphenyl)carbamate chloride |
|---|---|
| PubChem CID | 30013 |
| Molecular Formula | C15H22Cl2N2O2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-piperidin-1-ium-1-ylethyl N-(5-chloro-2-methylphenyl)carbamate chloride |
| SMILES | Cc1ccc(Cl)cc1NC(=O)OCC[NH+]1CCCCC1.[Cl-] |
| InChI | InChI=1S/C15H21ClN2O2.ClH/c1-12-5-6-13(16)11-14(12)17-15(19)20-10-9-18-7-3-2-4-8-18;/h5-6,11H,2-4,7-10H2,1H3,(H,17,19);1H |
| InChIKey | FKBLZCPLUWMJOP-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |