C17H20ClN3S — CID 3001367
12-chloro-7-(3-methylbut-2-enyl)-2,4,7-triazatetracyclo[6.5.2.04,14.011,15]pentadeca-1(13),11,14-triene-3-thione (PubChem CID 3001367) has the molecular formula C17H20ClN3S and a molecular weight of 333.89 g/mol. Its IUPAC name is 12-chloro-7-(3-methylbut-2-enyl)-2,4,7-triazatetracyclo[6.5.2.04,14.011,15]pentadeca-1(13),11,14-triene-3-thione.
| Compound Name | 12-chloro-7-(3-methylbut-2-enyl)-2,4,7-triazatetracyclo[6.5.2.04,14.011,15]pentadeca-1(13),11,14-triene-3-thione |
|---|---|
| PubChem CID | 3001367 |
| Molecular Formula | C17H20ClN3S |
| Molecular Weight | 333.89 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 12-chloro-7-(3-methylbut-2-enyl)-2,4,7-triazatetracyclo[6.5.2.04,14.011,15]pentadeca-1(13),11,14-triene-3-thione |
| SMILES | CC(C)=CCN1CCn2c(=S)[nH]c3cc(Cl)c4c(c32)C1CC4 |
| InChI | InChI=1S/C17H20ClN3S/c1-10(2)5-6-20-7-8-21-16-13(19-17(21)22)9-12(18)11-3-4-14(20)15(11)16/h5,9,14H,3-4,6-8H2,1-2H3,(H,19,22) |
| InChIKey | IDVVAKCLRRWZNG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.89 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|