About (4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide
(4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide (PubChem CID 3001388) has the molecular formula C11H16N4O2S
and a molecular weight of 268.34 g/mol. Its IUPAC name is (4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide.
Molecular Properties
| Compound Name | (4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide |
| PubChem CID | 3001388 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide |
| SMILES | CCc1cc(C(N)=S)ccn1.N[C@@H]1CONC1=O |
| InChI | InChI=1S/C8H10N2S.C3H6N2O2/c1-2-7-5-6(8(9)11)3-4-10-7;4-2-1-7-5-3(2)6/h3-5H,2H2,1H3,(H2,9,11);2H,1,4H2,(H,5,6)/t;2-/m.1/s1 |
| InChIKey | HXPKIKQRQZWSBE-ARGLLVQISA-N |
| XLogP | -0.35 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide?
The IUPAC name of (4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide (CID 3001388) is (4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide.
What is the SMILES notation for (4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide?
The canonical SMILES for (4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide is CCc1cc(C(N)=S)ccn1.N[C@@H]1CONC1=O.
What is the InChIKey of (4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide?
The InChIKey is HXPKIKQRQZWSBE-ARGLLVQISA-N. The full InChI is InChI=1S/C8H10N2S.C3H6N2O2/c1-2-7-5-6(8(9)11)3-4-10-7;4-2-1-7-5-3(2)6/h3-5H,2H2,1H3,(H2,9,11);2H,1,4H2,(H,5,6)/t;2-/m.1/s1.
What are the key properties of (4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide?
(4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide has a molecular weight of 268.34 g/mol, XLogP of -0.35, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-amino-1,2-oxazolidin-3-one;2-ethylpyridine-4-carbothioamide is sourced from PubChem (CID 3001388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).