C15H15N7OS — CID 3001606
5-methyl-4-[[4-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl]diazenyl]-1,2-dihydropyrazol-3-one (PubChem CID 3001606) has the molecular formula C15H15N7OS and a molecular weight of 341.40 g/mol. Its IUPAC name is 5-methyl-4-[[4-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl]diazenyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-methyl-4-[[4-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl]diazenyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 3001606 |
| Molecular Formula | C15H15N7OS |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 5-methyl-4-[[4-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)phenyl]diazenyl]-1,2-dihydropyrazol-3-one |
| SMILES | C=CCn1c(-c2ccc(/N=N/c3c(C)[nH][nH]c3=O)cc2)n[nH]c1=S |
| InChI | InChI=1S/C15H15N7OS/c1-3-8-22-13(19-21-15(22)24)10-4-6-11(7-5-10)17-18-12-9(2)16-20-14(12)23/h3-7H,1,8H2,2H3,(H,21,24)(H2,16,20,23)/b18-17+ |
| InChIKey | CZIDPYTXIFMIIL-ISLYRVAYSA-N |
| XLogP | 3.53 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|