C12H10N6O2S — CID 3001608
5-methyl-4-[[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]diazenyl]-1,2-dihydropyrazol-3-one (PubChem CID 3001608) has the molecular formula C12H10N6O2S and a molecular weight of 302.32 g/mol. Its IUPAC name is 5-methyl-4-[[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]diazenyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-methyl-4-[[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]diazenyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 3001608 |
| Molecular Formula | C12H10N6O2S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 5-methyl-4-[[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]diazenyl]-1,2-dihydropyrazol-3-one |
| SMILES | Cc1[nH][nH]c(=O)c1/N=N/c1ccc(-c2n[nH]c(=S)o2)cc1 |
| InChI | InChI=1S/C12H10N6O2S/c1-6-9(10(19)16-13-6)15-14-8-4-2-7(3-5-8)11-17-18-12(21)20-11/h2-5H,1H3,(H,18,21)(H2,13,16,19)/b15-14+ |
| InChIKey | DZDZXZJDEXHKJP-CCEZHUSRSA-N |
| XLogP | 3.14 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|