C44H32N4O4Zn — CID 3001849
zinc 2-[(1Z,5Z,9Z,14Z)-10,15-bis(2-hydroxyphenyl)-20-(2-oxidophenyl)-4,11,21,22,23,24-hexahydroporphyrin-5-yl]phenolate (PubChem CID 3001849) has the molecular formula C44H32N4O4Zn and a molecular weight of 746.15 g/mol. Its IUPAC name is zinc 2-[(1Z,5Z,9Z,14Z)-10,15-bis(2-hydroxyphenyl)-20-(2-oxidophenyl)-4,11,21,22,23,24-hexahydroporphyrin-5-yl]phenolate.
| Compound Name | zinc 2-[(1Z,5Z,9Z,14Z)-10,15-bis(2-hydroxyphenyl)-20-(2-oxidophenyl)-4,11,21,22,23,24-hexahydroporphyrin-5-yl]phenolate |
|---|---|
| PubChem CID | 3001849 |
| Molecular Formula | C44H32N4O4Zn |
| Molecular Weight | 746.15 g/mol |
| Exact Mass | 744.17 |
| IUPAC Name | zinc 2-[(1Z,5Z,9Z,14Z)-10,15-bis(2-hydroxyphenyl)-20-(2-oxidophenyl)-4,11,21,22,23,24-hexahydroporphyrin-5-yl]phenolate |
| SMILES | [O-]c1ccccc1/C1=C2\C=CC(N2)/C(c2ccccc2[O-])=c2/cc/c([nH]2)=C(\c2ccccc2O)C2C=C/C(=C(\c3ccccc3O)c3ccc1[nH]3)N2.[Zn+2] |
| InChI | InChI=1S/C44H34N4O4.Zn/c49-37-13-5-1-9-25(37)41-29-17-19-31(45-29)42(26-10-2-6-14-38(26)50)33-21-23-35(47-33)44(28-12-4-8-16-40(28)52)36-24-22-34(48-36)43(32-20-18-30(41)46-32)27-11-3-7-15-39(27)51;/h1-24,29,34,45-52H;/q;+2/p-2/b41-30-,42-31-,43-32-,44-36-; |
| InChIKey | NACHPDHNKVCLBV-GAXAWVSKSA-L |
| XLogP | 4.59 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.15 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|