About piperazine-1,4-dicarbothiohydrazide
piperazine-1,4-dicarbothiohydrazide (PubChem CID 3001885) has the molecular formula C6H14N6S2
and a molecular weight of 234.35 g/mol. Its IUPAC name is piperazine-1,4-dicarbothiohydrazide.
Molecular Properties
| Compound Name | piperazine-1,4-dicarbothiohydrazide |
| PubChem CID | 3001885 |
| Molecular Formula | C6H14N6S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | piperazine-1,4-dicarbothiohydrazide |
| SMILES | NNC(=S)N1CCN(C(=S)NN)CC1 |
| InChI | InChI=1S/C6H14N6S2/c7-9-5(13)11-1-2-12(4-3-11)6(14)10-8/h1-4,7-8H2,(H,9,13)(H,10,14) |
| InChIKey | GISXBSSCHFURCK-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 82.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze piperazine-1,4-dicarbothiohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-1,4-dicarbothiohydrazide?
The IUPAC name of piperazine-1,4-dicarbothiohydrazide (CID 3001885) is piperazine-1,4-dicarbothiohydrazide.
What is the SMILES notation for piperazine-1,4-dicarbothiohydrazide?
The canonical SMILES for piperazine-1,4-dicarbothiohydrazide is NNC(=S)N1CCN(C(=S)NN)CC1.
What is the InChIKey of piperazine-1,4-dicarbothiohydrazide?
The InChIKey is GISXBSSCHFURCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N6S2/c7-9-5(13)11-1-2-12(4-3-11)6(14)10-8/h1-4,7-8H2,(H,9,13)(H,10,14).
What are the key properties of piperazine-1,4-dicarbothiohydrazide?
piperazine-1,4-dicarbothiohydrazide has a molecular weight of 234.35 g/mol, XLogP of -1.90, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-1,4-dicarbothiohydrazide is sourced from PubChem (CID 3001885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).