C11H15N3S — CID 3002239
4-piperidin-1-ylpyridine-2-carbothioamide (PubChem CID 3002239) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 4-piperidin-1-ylpyridine-2-carbothioamide.
| Compound Name | 4-piperidin-1-ylpyridine-2-carbothioamide |
|---|---|
| PubChem CID | 3002239 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4-piperidin-1-ylpyridine-2-carbothioamide |
| SMILES | NC(=S)c1cc(N2CCCCC2)ccn1 |
| InChI | InChI=1S/C11H15N3S/c12-11(15)10-8-9(4-5-13-10)14-6-2-1-3-7-14/h4-5,8H,1-3,6-7H2,(H2,12,15) |
| InChIKey | UNUCZCNJUXDVOV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|