C24H30ClN4O6PS — CID 3002784
(11S)-6-chloro-11-methyl-10-(3-methylbut-2-enyl)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-thione;(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate (PubChem CID 3002784) has the molecular formula C24H30ClN4O6PS and a molecular weight of 569.02 g/mol. Its IUPAC name is (11S)-6-chloro-11-methyl-10-(3-methylbut-2-enyl)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-thione;(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate.
| Compound Name | (11S)-6-chloro-11-methyl-10-(3-methylbut-2-enyl)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-thione;(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 3002784 |
| Molecular Formula | C24H30ClN4O6PS |
| Molecular Weight | 569.02 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | (11S)-6-chloro-11-methyl-10-(3-methylbut-2-enyl)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-thione;(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate |
| SMILES | CC(C)=CCN1Cc2cc(Cl)cc3[nH]c(=S)n(c23)C[C@@H]1C.Cc1ncc(COP(=O)(O)O)c(C=O)c1O |
| InChI | InChI=1S/C16H20ClN3S.C8H10NO6P/c1-10(2)4-5-19-9-12-6-13(17)7-14-15(12)20(8-11(19)3)16(21)18-14;1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14/h4,6-7,11H,5,8-9H2,1-3H3,(H,18,21);2-3,11H,4H2,1H3,(H2,12,13,14)/t11-;/m0./s1 |
| InChIKey | CJEXNMUKEPJLIW-MERQFXBCSA-N |
| XLogP | 5.04 |
| TPSA | 140.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.02 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|