C10H10N2O2S — CID 30028427
[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methanethiol (PubChem CID 30028427) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methanethiol.
| Compound Name | [3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 30028427 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | [3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methanethiol |
| SMILES | COc1ccc(-c2noc(CS)n2)cc1 |
| InChI | InChI=1S/C10H10N2O2S/c1-13-8-4-2-7(3-5-8)10-11-9(6-15)14-12-10/h2-5,15H,6H2,1H3 |
| InChIKey | DJSZUKHHQJWKTO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 48.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|