C17H17N5S2 — CID 3002889
1-[4-[5-(ethylamino)-1,3,4-thiadiazol-2-yl]phenyl]-3-phenylthiourea (PubChem CID 3002889) has the molecular formula C17H17N5S2 and a molecular weight of 355.49 g/mol. Its IUPAC name is 1-[4-[5-(ethylamino)-1,3,4-thiadiazol-2-yl]phenyl]-3-phenylthiourea.
| Compound Name | 1-[4-[5-(ethylamino)-1,3,4-thiadiazol-2-yl]phenyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 3002889 |
| Molecular Formula | C17H17N5S2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 1-[4-[5-(ethylamino)-1,3,4-thiadiazol-2-yl]phenyl]-3-phenylthiourea |
| SMILES | CCNc1nnc(-c2ccc(NC(=S)Nc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C17H17N5S2/c1-2-18-17-22-21-15(24-17)12-8-10-14(11-9-12)20-16(23)19-13-6-4-3-5-7-13/h3-11H,2H2,1H3,(H,18,22)(H2,19,20,23) |
| InChIKey | CUWYZDRREWBUEC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|