C20H20N2O4 — CID 30029077
4-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methoxy]benzoic acid (PubChem CID 30029077) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 4-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methoxy]benzoic acid.
| Compound Name | 4-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 30029077 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 4-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methoxy]benzoic acid |
| SMILES | CC(C)(C)c1ccc(-c2noc(COc3ccc(C(=O)O)cc3)n2)cc1 |
| InChI | InChI=1S/C20H20N2O4/c1-20(2,3)15-8-4-13(5-9-15)18-21-17(26-22-18)12-25-16-10-6-14(7-11-16)19(23)24/h4-11H,12H2,1-3H3,(H,23,24) |
| InChIKey | VQIKQSGFNWDKPF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |