About 3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine
3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 30029896) has the molecular formula C8H10Cl2N2
and a molecular weight of 205.09 g/mol. Its IUPAC name is 3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine |
| PubChem CID | 30029896 |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | CN(C)c1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C8H10Cl2N2/c1-12(2)8-6(10)3-5(9)4-7(8)11/h3-4H,11H2,1-2H3 |
| InChIKey | VROWZZUXTOGBRI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine?
The IUPAC name of 3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine (CID 30029896) is 3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine.
What is the SMILES notation for 3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine?
The canonical SMILES for 3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine is CN(C)c1c(N)cc(Cl)cc1Cl.
What is the InChIKey of 3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine?
The InChIKey is VROWZZUXTOGBRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Cl2N2/c1-12(2)8-6(10)3-5(9)4-7(8)11/h3-4H,11H2,1-2H3.
What are the key properties of 3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine?
3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine has a molecular weight of 205.09 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-2-N,2-N-dimethylbenzene-1,2-diamine is sourced from PubChem (CID 30029896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).