C17H11N3OS3 — CID 3003120
3,6-diphenyl-2,5-bis(sulfanylidene)-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 3003120) has the molecular formula C17H11N3OS3 and a molecular weight of 369.50 g/mol. Its IUPAC name is 3,6-diphenyl-2,5-bis(sulfanylidene)-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 3,6-diphenyl-2,5-bis(sulfanylidene)-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 3003120 |
| Molecular Formula | C17H11N3OS3 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 3,6-diphenyl-2,5-bis(sulfanylidene)-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=c1c2sc(=S)n(-c3ccccc3)c2[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C17H11N3OS3/c21-15-13-14(18-16(22)20(15)12-9-5-2-6-10-12)19(17(23)24-13)11-7-3-1-4-8-11/h1-10H,(H,18,22) |
| InChIKey | LJPYMEUGNUFYFF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 42.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|