C18H13N3OS3 — CID 3003121
6-(2-methylphenyl)-3-phenyl-2,5-bis(sulfanylidene)-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 3003121) has the molecular formula C18H13N3OS3 and a molecular weight of 383.52 g/mol. Its IUPAC name is 6-(2-methylphenyl)-3-phenyl-2,5-bis(sulfanylidene)-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 6-(2-methylphenyl)-3-phenyl-2,5-bis(sulfanylidene)-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 3003121 |
| Molecular Formula | C18H13N3OS3 |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 6-(2-methylphenyl)-3-phenyl-2,5-bis(sulfanylidene)-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | Cc1ccccc1-n1c(=S)[nH]c2c(sc(=S)n2-c2ccccc2)c1=O |
| InChI | InChI=1S/C18H13N3OS3/c1-11-7-5-6-10-13(11)21-16(22)14-15(19-17(21)23)20(18(24)25-14)12-8-3-2-4-9-12/h2-10H,1H3,(H,19,23) |
| InChIKey | SDJMPEPQGRAEME-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 42.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|