About 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile
5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile (PubChem CID 30032109) has the molecular formula C13H9Cl2NO2S
and a molecular weight of 314.19 g/mol. Its IUPAC name is 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile |
| PubChem CID | 30032109 |
| Molecular Formula | C13H9Cl2NO2S |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile |
| SMILES | N#Cc1ccc(-c2ccc(SCCO)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C13H9Cl2NO2S/c14-12-9(10-3-1-8(7-16)18-10)2-4-11(13(12)15)19-6-5-17/h1-4,17H,5-6H2 |
| InChIKey | YTVAPMJXMQXBHR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 57.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile?
The IUPAC name of 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile (CID 30032109) is 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile.
What is the SMILES notation for 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile?
The canonical SMILES for 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile is N#Cc1ccc(-c2ccc(SCCO)c(Cl)c2Cl)o1.
What is the InChIKey of 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile?
The InChIKey is YTVAPMJXMQXBHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2NO2S/c14-12-9(10-3-1-8(7-16)18-10)2-4-11(13(12)15)19-6-5-17/h1-4,17H,5-6H2.
What are the key properties of 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile?
5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile has a molecular weight of 314.19 g/mol, XLogP of 4.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,3-dichloro-4-(2-hydroxyethylsulfanyl)phenyl]furan-2-carbonitrile is sourced from PubChem (CID 30032109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).