C10H12N4S2 — CID 30032207
[(4,5-dimethyl-1,3-benzothiazol-2-yl)amino]thiourea (PubChem CID 30032207) has the molecular formula C10H12N4S2 and a molecular weight of 252.37 g/mol. Its IUPAC name is [(4,5-dimethyl-1,3-benzothiazol-2-yl)amino]thiourea.
| Compound Name | [(4,5-dimethyl-1,3-benzothiazol-2-yl)amino]thiourea |
|---|---|
| PubChem CID | 30032207 |
| Molecular Formula | C10H12N4S2 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | [(4,5-dimethyl-1,3-benzothiazol-2-yl)amino]thiourea |
| SMILES | Cc1ccc2sc(NNC(N)=S)nc2c1C |
| InChI | InChI=1S/C10H12N4S2/c1-5-3-4-7-8(6(5)2)12-10(16-7)14-13-9(11)15/h3-4H,1-2H3,(H,12,14)(H3,11,13,15) |
| InChIKey | WLHDPNDYOBGRMS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|