About 2-chloro-1-ethyl-4,5-dimethylimidazole
2-chloro-1-ethyl-4,5-dimethylimidazole (PubChem CID 30033031) has the molecular formula C7H11ClN2
and a molecular weight of 158.63 g/mol. Its IUPAC name is 2-chloro-1-ethyl-4,5-dimethylimidazole.
Molecular Properties
| Compound Name | 2-chloro-1-ethyl-4,5-dimethylimidazole |
| PubChem CID | 30033031 |
| Molecular Formula | C7H11ClN2 |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 2-chloro-1-ethyl-4,5-dimethylimidazole |
| SMILES | CCn1c(Cl)nc(C)c1C |
| InChI | InChI=1S/C7H11ClN2/c1-4-10-6(3)5(2)9-7(10)8/h4H2,1-3H3 |
| InChIKey | MIRMSSTWFDJLPY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-1-ethyl-4,5-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-ethyl-4,5-dimethylimidazole?
The IUPAC name of 2-chloro-1-ethyl-4,5-dimethylimidazole (CID 30033031) is 2-chloro-1-ethyl-4,5-dimethylimidazole.
What is the SMILES notation for 2-chloro-1-ethyl-4,5-dimethylimidazole?
The canonical SMILES for 2-chloro-1-ethyl-4,5-dimethylimidazole is CCn1c(Cl)nc(C)c1C.
What is the InChIKey of 2-chloro-1-ethyl-4,5-dimethylimidazole?
The InChIKey is MIRMSSTWFDJLPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN2/c1-4-10-6(3)5(2)9-7(10)8/h4H2,1-3H3.
What are the key properties of 2-chloro-1-ethyl-4,5-dimethylimidazole?
2-chloro-1-ethyl-4,5-dimethylimidazole has a molecular weight of 158.63 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-ethyl-4,5-dimethylimidazole is sourced from PubChem (CID 30033031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).