About (4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole
(4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole (PubChem CID 3003771) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is (4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole.
Molecular Properties
| Compound Name | (4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole |
| PubChem CID | 3003771 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole |
| SMILES | CC/C(C)=C1\CC(C)(C)N=C1C |
| InChI | InChI=1S/C11H19N/c1-6-8(2)10-7-11(4,5)12-9(10)3/h6-7H2,1-5H3/b10-8+ |
| InChIKey | CIKOYDSGGAIVHQ-CSKARUKUSA-N |
| XLogP | 3.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole?
The IUPAC name of (4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole (CID 3003771) is (4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole.
What is the SMILES notation for (4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole?
The canonical SMILES for (4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole is CC/C(C)=C1\CC(C)(C)N=C1C.
What is the InChIKey of (4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole?
The InChIKey is CIKOYDSGGAIVHQ-CSKARUKUSA-N. The full InChI is InChI=1S/C11H19N/c1-6-8(2)10-7-11(4,5)12-9(10)3/h6-7H2,1-5H3/b10-8+.
What are the key properties of (4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole?
(4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole has a molecular weight of 165.28 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-butan-2-ylidene-2,2,5-trimethyl-3H-pyrrole is sourced from PubChem (CID 3003771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).