C7H9N3S — CID 3003835
7-methyl-1,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidine-4-thione (PubChem CID 3003835) has the molecular formula C7H9N3S and a molecular weight of 167.24 g/mol. Its IUPAC name is 7-methyl-1,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidine-4-thione.
| Compound Name | 7-methyl-1,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 3003835 |
| Molecular Formula | C7H9N3S |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 7-methyl-1,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidine-4-thione |
| SMILES | CC1NCc2c1[nH]cnc2=S |
| InChI | InChI=1S/C7H9N3S/c1-4-6-5(2-8-4)7(11)10-3-9-6/h3-4,8H,2H2,1H3,(H,9,10,11) |
| InChIKey | LCKSTGZYVZCLND-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|