C6H12N2O6S4 — CID 3003899
2-[[2-sulfanylidene-2-(2-sulfoethylamino)ethanethioyl]amino]ethanesulfonic acid (PubChem CID 3003899) has the molecular formula C6H12N2O6S4 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[[2-sulfanylidene-2-(2-sulfoethylamino)ethanethioyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[2-sulfanylidene-2-(2-sulfoethylamino)ethanethioyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 3003899 |
| Molecular Formula | C6H12N2O6S4 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 2-[[2-sulfanylidene-2-(2-sulfoethylamino)ethanethioyl]amino]ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCNC(=S)C(=S)NCCS(=O)(=O)O |
| InChI | InChI=1S/C6H12N2O6S4/c9-17(10,11)3-1-7-5(15)6(16)8-2-4-18(12,13)14/h1-4H2,(H,7,15)(H,8,16)(H,9,10,11)(H,12,13,14) |
| InChIKey | AATGZJNACTTWRT-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|