C30H44N4O2S2 — CID 3003990
(4E)-3-cyclohexyl-4-(3-cyclohexyl-2-cyclohexylimino-5-oxo-1,3-thiazolidin-4-ylidene)-2-cyclohexylimino-1,3-thiazolidin-5-one (PubChem CID 3003990) has the molecular formula C30H44N4O2S2 and a molecular weight of 556.84 g/mol. Its IUPAC name is (4E)-3-cyclohexyl-4-(3-cyclohexyl-2-cyclohexylimino-5-oxo-1,3-thiazolidin-4-ylidene)-2-cyclohexylimino-1,3-thiazolidin-5-one.
| Compound Name | (4E)-3-cyclohexyl-4-(3-cyclohexyl-2-cyclohexylimino-5-oxo-1,3-thiazolidin-4-ylidene)-2-cyclohexylimino-1,3-thiazolidin-5-one |
|---|---|
| PubChem CID | 3003990 |
| Molecular Formula | C30H44N4O2S2 |
| Molecular Weight | 556.84 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | (4E)-3-cyclohexyl-4-(3-cyclohexyl-2-cyclohexylimino-5-oxo-1,3-thiazolidin-4-ylidene)-2-cyclohexylimino-1,3-thiazolidin-5-one |
| SMILES | O=C1S/C(=N\C2CCCCC2)N(C2CCCCC2)/C1=C1\C(=O)S/C(=N\C2CCCCC2)N1C1CCCCC1 |
| InChI | InChI=1S/C30H44N4O2S2/c35-27-25(33(23-17-9-3-10-18-23)29(37-27)31-21-13-5-1-6-14-21)26-28(36)38-30(32-22-15-7-2-8-16-22)34(26)24-19-11-4-12-20-24/h21-24H,1-20H2/b26-25+,31-29-,32-30- |
| InChIKey | CTTJOODRQAQKSE-RGCBFNRSSA-N |
| XLogP | 7.39 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.84 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|