About (E)-2-methylsulfanyl-1,2-diphenylethenethiol
(E)-2-methylsulfanyl-1,2-diphenylethenethiol (PubChem CID 3004109) has the molecular formula C15H14S2
and a molecular weight of 258.41 g/mol. Its IUPAC name is (E)-2-methylsulfanyl-1,2-diphenylethenethiol.
Molecular Properties
| Compound Name | (E)-2-methylsulfanyl-1,2-diphenylethenethiol |
| PubChem CID | 3004109 |
| Molecular Formula | C15H14S2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | (E)-2-methylsulfanyl-1,2-diphenylethenethiol |
| SMILES | CS/C(=C(/S)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14S2/c1-17-15(13-10-6-3-7-11-13)14(16)12-8-4-2-5-9-12/h2-11,16H,1H3/b15-14+ |
| InChIKey | XMPSARMVOPXBCD-CCEZHUSRSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-methylsulfanyl-1,2-diphenylethenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-methylsulfanyl-1,2-diphenylethenethiol?
The IUPAC name of (E)-2-methylsulfanyl-1,2-diphenylethenethiol (CID 3004109) is (E)-2-methylsulfanyl-1,2-diphenylethenethiol.
What is the SMILES notation for (E)-2-methylsulfanyl-1,2-diphenylethenethiol?
The canonical SMILES for (E)-2-methylsulfanyl-1,2-diphenylethenethiol is CS/C(=C(/S)c1ccccc1)c1ccccc1.
What is the InChIKey of (E)-2-methylsulfanyl-1,2-diphenylethenethiol?
The InChIKey is XMPSARMVOPXBCD-CCEZHUSRSA-N. The full InChI is InChI=1S/C15H14S2/c1-17-15(13-10-6-3-7-11-13)14(16)12-8-4-2-5-9-12/h2-11,16H,1H3/b15-14+.
What are the key properties of (E)-2-methylsulfanyl-1,2-diphenylethenethiol?
(E)-2-methylsulfanyl-1,2-diphenylethenethiol has a molecular weight of 258.41 g/mol, XLogP of 4.81, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-methylsulfanyl-1,2-diphenylethenethiol is sourced from PubChem (CID 3004109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).