C25H25BrN2O — CID 3004116
(14E)-16-benzyl-14-(1-bromopropylidene)-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-13-one (PubChem CID 3004116) has the molecular formula C25H25BrN2O and a molecular weight of 449.39 g/mol. Its IUPAC name is (14E)-16-benzyl-14-(1-bromopropylidene)-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-13-one.
| Compound Name | (14E)-16-benzyl-14-(1-bromopropylidene)-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-13-one |
|---|---|
| PubChem CID | 3004116 |
| Molecular Formula | C25H25BrN2O |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | (14E)-16-benzyl-14-(1-bromopropylidene)-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-13-one |
| SMILES | CC/C(Br)=C1/CC2c3c(c4ccccc4n3C)CC(C1=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C25H25BrN2O/c1-3-20(26)19-14-22-24-18(17-11-7-8-12-21(17)27(24)2)13-23(25(19)29)28(22)15-16-9-5-4-6-10-16/h4-12,22-23H,3,13-15H2,1-2H3/b20-19+ |
| InChIKey | JVMFXCYHJPLXJS-FMQUCBEESA-N |
| XLogP | 5.68 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|