C15H13N3S — CID 3004171
5-benzhydryl-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 3004171) has the molecular formula C15H13N3S and a molecular weight of 267.36 g/mol. Its IUPAC name is 5-benzhydryl-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-benzhydryl-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 3004171 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 5-benzhydryl-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | S=c1nc(C(c2ccccc2)c2ccccc2)[nH][nH]1 |
| InChI | InChI=1S/C15H13N3S/c19-15-16-14(17-18-15)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H2,16,17,18,19) |
| InChIKey | KXOBDTBTPWCGCP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|