C10H7Cl2N7OS — CID 3004184
4-amino-3-[(5,7-dichloro-2-hydroxy-1H-indol-3-yl)diazenyl]-1H-1,2,4-triazole-5-thione (PubChem CID 3004184) has the molecular formula C10H7Cl2N7OS and a molecular weight of 344.19 g/mol. Its IUPAC name is 4-amino-3-[(5,7-dichloro-2-hydroxy-1H-indol-3-yl)diazenyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-[(5,7-dichloro-2-hydroxy-1H-indol-3-yl)diazenyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 3004184 |
| Molecular Formula | C10H7Cl2N7OS |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 4-amino-3-[(5,7-dichloro-2-hydroxy-1H-indol-3-yl)diazenyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Nn1c(/N=N/c2c(O)[nH]c3c(Cl)cc(Cl)cc23)n[nH]c1=S |
| InChI | InChI=1S/C10H7Cl2N7OS/c11-3-1-4-6(5(12)2-3)14-8(20)7(4)15-16-9-17-18-10(21)19(9)13/h1-2,14,20H,13H2,(H,18,21)/b16-15+ |
| InChIKey | SLETXGXTGUJQHH-FOCLMDBBSA-N |
| XLogP | 3.56 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|